C14H18O2 — CID 143056811
(4Z)-8-methoxy-3,3-dimethyl-2,6-dihydro-1-benzoxocine (PubChem CID 143056811) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (4Z)-8-methoxy-3,3-dimethyl-2,6-dihydro-1-benzoxocine.
| Compound Name | (4Z)-8-methoxy-3,3-dimethyl-2,6-dihydro-1-benzoxocine |
|---|---|
| PubChem CID | 143056811 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (4Z)-8-methoxy-3,3-dimethyl-2,6-dihydro-1-benzoxocine |
| SMILES | COc1ccc2c(c1)C/C=C\C(C)(C)CO2 |
| InChI | InChI=1S/C14H18O2/c1-14(2)8-4-5-11-9-12(15-3)6-7-13(11)16-10-14/h4,6-9H,5,10H2,1-3H3/b8-4- |
| InChIKey | IHSIIXMNTWNPAP-YWEYNIOJSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|