C13H16O2 — CID 141173693
6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclobutane] (PubChem CID 141173693) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclobutane].
| Compound Name | 6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclobutane] |
|---|---|
| PubChem CID | 141173693 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclobutane] |
| SMILES | COc1ccc2c(c1)CCC1(CCC1)O2 |
| InChI | InChI=1S/C13H16O2/c1-14-11-3-4-12-10(9-11)5-8-13(15-12)6-2-7-13/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | DYRFQHREFWLROE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |