C22H32O2 — CID 5270701
(1S,10R,11S)-6-methoxy-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene (PubChem CID 5270701) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (1S,10R,11S)-6-methoxy-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene.
| Compound Name | (1S,10R,11S)-6-methoxy-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene |
|---|---|
| PubChem CID | 5270701 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (1S,10R,11S)-6-methoxy-10,11,15,15-tetramethyl-2-oxatetracyclo[8.8.0.01,14.03,8]octadeca-3(8),4,6-triene |
| SMILES | COc1ccc2c(c1)C[C@]1(C)[C@@H](C)CCC3C(C)(C)CCC[C@]31O2 |
| InChI | InChI=1S/C22H32O2/c1-15-7-10-19-20(2,3)11-6-12-22(19)21(15,4)14-16-13-17(23-5)8-9-18(16)24-22/h8-9,13,15,19H,6-7,10-12,14H2,1-5H3/t15-,19?,21+,22-/m0/s1 |
| InChIKey | GFZLFKCEWJJEFW-QANXQLDVSA-N |
| XLogP | 5.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |