C19H20O2S2 — CID 102346815
(3'S)-6'-methoxy-3'-phenylspiro[1,3-dithiane-2,2'-3,4-dihydrochromene] (PubChem CID 102346815) has the molecular formula C19H20O2S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is (3'S)-6'-methoxy-3'-phenylspiro[1,3-dithiane-2,2'-3,4-dihydrochromene].
| Compound Name | (3'S)-6'-methoxy-3'-phenylspiro[1,3-dithiane-2,2'-3,4-dihydrochromene] |
|---|---|
| PubChem CID | 102346815 |
| Molecular Formula | C19H20O2S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (3'S)-6'-methoxy-3'-phenylspiro[1,3-dithiane-2,2'-3,4-dihydrochromene] |
| SMILES | COc1ccc2c(c1)C[C@@H](c1ccccc1)C1(O2)SCCCS1 |
| InChI | InChI=1S/C19H20O2S2/c1-20-16-8-9-18-15(12-16)13-17(14-6-3-2-4-7-14)19(21-18)22-10-5-11-23-19/h2-4,6-9,12,17H,5,10-11,13H2,1H3/t17-/m0/s1 |
| InChIKey | QNXMEGSEZCPRFD-KRWDZBQOSA-N |
| XLogP | 4.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |