C14H20O4 — CID 131862776
2,2-diethoxy-6-methoxy-3,4-dihydrochromene (PubChem CID 131862776) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2,2-diethoxy-6-methoxy-3,4-dihydrochromene.
| Compound Name | 2,2-diethoxy-6-methoxy-3,4-dihydrochromene |
|---|---|
| PubChem CID | 131862776 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2,2-diethoxy-6-methoxy-3,4-dihydrochromene |
| SMILES | CCOC1(OCC)CCc2cc(OC)ccc2O1 |
| InChI | InChI=1S/C14H20O4/c1-4-16-14(17-5-2)9-8-11-10-12(15-3)6-7-13(11)18-14/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | ZSKNGVLHXCXORH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|