C11H6F8O — CID 165383709
1,1,2,2,3,3,4,4-octafluoro-6-methoxynaphthalene (PubChem CID 165383709) has the molecular formula C11H6F8O and a molecular weight of 306.15 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoro-6-methoxynaphthalene.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoro-6-methoxynaphthalene |
|---|---|
| PubChem CID | 165383709 |
| Molecular Formula | C11H6F8O |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoro-6-methoxynaphthalene |
| SMILES | COc1ccc2c(c1)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C11H6F8O/c1-20-5-2-3-6-7(4-5)9(14,15)11(18,19)10(16,17)8(6,12)13/h2-4H,1H3 |
| InChIKey | QJXXNIIJWQOMEN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|