C17H15ClN2O — CID 79370255
1-(2-chloroanilino)-6-methoxy-2,3-dihydroindene-1-carbonitrile (PubChem CID 79370255) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 1-(2-chloroanilino)-6-methoxy-2,3-dihydroindene-1-carbonitrile.
| Compound Name | 1-(2-chloroanilino)-6-methoxy-2,3-dihydroindene-1-carbonitrile |
|---|---|
| PubChem CID | 79370255 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-(2-chloroanilino)-6-methoxy-2,3-dihydroindene-1-carbonitrile |
| SMILES | COc1ccc2c(c1)C(C#N)(Nc1ccccc1Cl)CC2 |
| InChI | InChI=1S/C17H15ClN2O/c1-21-13-7-6-12-8-9-17(11-19,14(12)10-13)20-16-5-3-2-4-15(16)18/h2-7,10,20H,8-9H2,1H3 |
| InChIKey | PEGRSNRPBUINNX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |