C16H13ClN2S — CID 60990456
4-(2-chloroanilino)-2,3-dihydrothiochromene-4-carbonitrile (PubChem CID 60990456) has the molecular formula C16H13ClN2S and a molecular weight of 300.81 g/mol. Its IUPAC name is 4-(2-chloroanilino)-2,3-dihydrothiochromene-4-carbonitrile.
| Compound Name | 4-(2-chloroanilino)-2,3-dihydrothiochromene-4-carbonitrile |
|---|---|
| PubChem CID | 60990456 |
| Molecular Formula | C16H13ClN2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 4-(2-chloroanilino)-2,3-dihydrothiochromene-4-carbonitrile |
| SMILES | N#CC1(Nc2ccccc2Cl)CCSc2ccccc21 |
| InChI | InChI=1S/C16H13ClN2S/c17-13-6-2-3-7-14(13)19-16(11-18)9-10-20-15-8-4-1-5-12(15)16/h1-8,19H,9-10H2 |
| InChIKey | WCQQXWRAKSUOJZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |