C16H13FN2S — CID 60990319
4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile (PubChem CID 60990319) has the molecular formula C16H13FN2S and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile.
| Compound Name | 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile |
|---|---|
| PubChem CID | 60990319 |
| Molecular Formula | C16H13FN2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile |
| SMILES | N#CC1(Nc2cccc(F)c2)CCSc2ccccc21 |
| InChI | InChI=1S/C16H13FN2S/c17-12-4-3-5-13(10-12)19-16(11-18)8-9-20-15-7-2-1-6-14(15)16/h1-7,10,19H,8-9H2 |
| InChIKey | HVLLZBXZFVRJKP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |