About 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile
4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile (PubChem CID 60990319) has the molecular formula C16H13FN2S
and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile.
Molecular Properties
| Compound Name | 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile |
| PubChem CID | 60990319 |
| Molecular Formula | C16H13FN2S |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile |
| SMILES | N#CC1(Nc2cccc(F)c2)CCSc2ccccc21 |
| InChI | InChI=1S/C16H13FN2S/c17-12-4-3-5-13(10-12)19-16(11-18)8-9-20-15-7-2-1-6-14(15)16/h1-7,10,19H,8-9H2 |
| InChIKey | HVLLZBXZFVRJKP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile?
The IUPAC name of 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile (CID 60990319) is 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile.
What is the SMILES notation for 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile?
The canonical SMILES for 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile is N#CC1(Nc2cccc(F)c2)CCSc2ccccc21.
What is the InChIKey of 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile?
The InChIKey is HVLLZBXZFVRJKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2S/c17-12-4-3-5-13(10-12)19-16(11-18)8-9-20-15-7-2-1-6-14(15)16/h1-7,10,19H,8-9H2.
What are the key properties of 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile?
4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile has a molecular weight of 284.36 g/mol, XLogP of 4.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoroanilino)-2,3-dihydrothiochromene-4-carbonitrile is sourced from PubChem (CID 60990319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).