C17H11F3N2S — CID 70532833
2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile (PubChem CID 70532833) has the molecular formula C17H11F3N2S and a molecular weight of 332.35 g/mol. Its IUPAC name is 2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile.
| Compound Name | 2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile |
|---|---|
| PubChem CID | 70532833 |
| Molecular Formula | C17H11F3N2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | 2-(4H-1,4-benzothiazin-3-ylidene)-2-[3-(trifluoromethyl)phenyl]acetonitrile |
| SMILES | N#CC(=C1CSc2ccccc2N1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11F3N2S/c18-17(19,20)12-5-3-4-11(8-12)13(9-21)15-10-23-16-7-2-1-6-14(16)22-15/h1-8,22H,10H2 |
| InChIKey | KXCACFVGDJUNTK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|