About 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine
4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine (PubChem CID 83231351) has the molecular formula C10H11F2NO2
and a molecular weight of 215.20 g/mol. Its IUPAC name is 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine.
Molecular Properties
| Compound Name | 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine |
| PubChem CID | 83231351 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine |
| SMILES | COc1ccc2c(c1)C(F)(F)C(N)CO2 |
| InChI | InChI=1S/C10H11F2NO2/c1-14-6-2-3-8-7(4-6)10(11,12)9(13)5-15-8/h2-4,9H,5,13H2,1H3 |
| InChIKey | CHWUOTKJIQCXNV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine?
The IUPAC name of 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine (CID 83231351) is 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine.
What is the SMILES notation for 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine?
The canonical SMILES for 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine is COc1ccc2c(c1)C(F)(F)C(N)CO2.
What is the InChIKey of 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine?
The InChIKey is CHWUOTKJIQCXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-14-6-2-3-8-7(4-6)10(11,12)9(13)5-15-8/h2-4,9H,5,13H2,1H3.
What are the key properties of 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine?
4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine has a molecular weight of 215.20 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine is sourced from PubChem (CID 83231351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).