C10H11F2NO2 — CID 83231351
4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine (PubChem CID 83231351) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine.
| Compound Name | 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine |
|---|---|
| PubChem CID | 83231351 |
| Molecular Formula | C10H11F2NO2 |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 4,4-difluoro-6-methoxy-2,3-dihydrochromen-3-amine |
| SMILES | COc1ccc2c(c1)C(F)(F)C(N)CO2 |
| InChI | InChI=1S/C10H11F2NO2/c1-14-6-2-3-8-7(4-6)10(11,12)9(13)5-15-8/h2-4,9H,5,13H2,1H3 |
| InChIKey | CHWUOTKJIQCXNV-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |