C10H11BrO3 — CID 10658909
3-(bromomethyl)-6-methoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 10658909) has the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. Its IUPAC name is 3-(bromomethyl)-6-methoxy-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-(bromomethyl)-6-methoxy-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 10658909 |
| Molecular Formula | C10H11BrO3 |
| Molecular Weight | 259.10 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 3-(bromomethyl)-6-methoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | COc1ccc2c(c1)OC(CBr)CO2 |
| InChI | InChI=1S/C10H11BrO3/c1-12-7-2-3-9-10(4-7)14-8(5-11)6-13-9/h2-4,8H,5-6H2,1H3 |
| InChIKey | SEOOLJFMLFULJT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.10 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|