About 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine
3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine (PubChem CID 13084419) has the molecular formula C9H7BrCl2O2
and a molecular weight of 297.96 g/mol. Its IUPAC name is 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 13084419 |
| Molecular Formula | C9H7BrCl2O2 |
| Molecular Weight | 297.96 g/mol |
| Exact Mass | 295.90 |
| IUPAC Name | 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine |
| SMILES | Clc1cc2c(cc1Cl)OC(CBr)CO2 |
| InChI | InChI=1S/C9H7BrCl2O2/c10-3-5-4-13-8-1-6(11)7(12)2-9(8)14-5/h1-2,5H,3-4H2 |
| InChIKey | AKECHHUMANPOQX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.96 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine (CID 13084419) is 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine is Clc1cc2c(cc1Cl)OC(CBr)CO2.
What is the InChIKey of 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine?
The InChIKey is AKECHHUMANPOQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrCl2O2/c10-3-5-4-13-8-1-6(11)7(12)2-9(8)14-5/h1-2,5H,3-4H2.
What are the key properties of 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine?
3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine has a molecular weight of 297.96 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)-6,7-dichloro-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 13084419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).