C15H14FNO4 — CID 10062845
N-[[(3S)-6-(4-fluorophenoxy)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]hydroxylamine (PubChem CID 10062845) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is N-[[(3S)-6-(4-fluorophenoxy)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]hydroxylamine.
| Compound Name | N-[[(3S)-6-(4-fluorophenoxy)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 10062845 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[[(3S)-6-(4-fluorophenoxy)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]hydroxylamine |
| SMILES | ONC[C@H]1COc2ccc(Oc3ccc(F)cc3)cc2O1 |
| InChI | InChI=1S/C15H14FNO4/c16-10-1-3-11(4-2-10)20-12-5-6-14-15(7-12)21-13(8-17-18)9-19-14/h1-7,13,17-18H,8-9H2/t13-/m0/s1 |
| InChIKey | NEOHGVLXWBSGES-ZDUSSCGKSA-N |
| XLogP | 2.74 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|