C42H52N2O3 — CID 164962461
(2S)-2-amino-N-[(3S)-6-(3,5-dimethylphenyl)-2-oxo-1-phenylhexan-3-yl]-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]propanamide (PubChem CID 164962461) has the molecular formula C42H52N2O3 and a molecular weight of 632.89 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3S)-6-(3,5-dimethylphenyl)-2-oxo-1-phenylhexan-3-yl]-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]propanamide.
| Compound Name | (2S)-2-amino-N-[(3S)-6-(3,5-dimethylphenyl)-2-oxo-1-phenylhexan-3-yl]-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]propanamide |
|---|---|
| PubChem CID | 164962461 |
| Molecular Formula | C42H52N2O3 |
| Molecular Weight | 632.89 g/mol |
| Exact Mass | 632.40 |
| IUPAC Name | (2S)-2-amino-N-[(3S)-6-(3,5-dimethylphenyl)-2-oxo-1-phenylhexan-3-yl]-3-[4-(2-ethyl-4-pentoxyphenyl)phenyl]propanamide |
| SMILES | CCCCCOc1ccc(-c2ccc(C[C@H](N)C(=O)N[C@@H](CCCc3cc(C)cc(C)c3)C(=O)Cc3ccccc3)cc2)c(CC)c1 |
| InChI | InChI=1S/C42H52N2O3/c1-5-7-11-23-47-37-21-22-38(35(6-2)29-37)36-19-17-33(18-20-36)27-39(43)42(46)44-40(41(45)28-32-13-9-8-10-14-32)16-12-15-34-25-30(3)24-31(4)26-34/h8-10,13-14,17-22,24-26,29,39-40H,5-7,11-12,15-16,23,27-28,43H2,1-4H3,(H,44,46)/t39-,40-/m0/s1 |
| InChIKey | YXLIRPBSURWERO-ZAQUEYBZSA-N |
| XLogP | 8.29 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.89 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|