C13H20N2O3 — CID 87750253
(2S)-2-amino-3-(4-butoxyphenyl)-N-hydroxypropanamide (PubChem CID 87750253) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-butoxyphenyl)-N-hydroxypropanamide.
| Compound Name | (2S)-2-amino-3-(4-butoxyphenyl)-N-hydroxypropanamide |
|---|---|
| PubChem CID | 87750253 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2S)-2-amino-3-(4-butoxyphenyl)-N-hydroxypropanamide |
| SMILES | CCCCOc1ccc(C[C@H](N)C(=O)NO)cc1 |
| InChI | InChI=1S/C13H20N2O3/c1-2-3-8-18-11-6-4-10(5-7-11)9-12(14)13(16)15-17/h4-7,12,17H,2-3,8-9,14H2,1H3,(H,15,16)/t12-/m0/s1 |
| InChIKey | KYGFAIZXKCHJCU-LBPRGKRZSA-N |
| XLogP | 1.24 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|