C20H25N3O — CID 170211340
4-(4-azidobutoxy)-2-ethyl-1-(4-ethylphenyl)benzene (PubChem CID 170211340) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(4-azidobutoxy)-2-ethyl-1-(4-ethylphenyl)benzene.
| Compound Name | 4-(4-azidobutoxy)-2-ethyl-1-(4-ethylphenyl)benzene |
|---|---|
| PubChem CID | 170211340 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 4-(4-azidobutoxy)-2-ethyl-1-(4-ethylphenyl)benzene |
| SMILES | CCc1ccc(-c2ccc(OCCCCN=[N+]=[N-])cc2CC)cc1 |
| InChI | InChI=1S/C20H25N3O/c1-3-16-7-9-18(10-8-16)20-12-11-19(15-17(20)4-2)24-14-6-5-13-22-23-21/h7-12,15H,3-6,13-14H2,1-2H3 |
| InChIKey | DLMWKUDFJGXROZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|