C56H51ClN4O5 — CID 176765651
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 176765651) has the molecular formula C56H51ClN4O5 and a molecular weight of 895.50 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 176765651 |
| Molecular Formula | C56H51ClN4O5 |
| Molecular Weight | 895.50 g/mol |
| Exact Mass | 894.35 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2S)-3-[4-[4-(4-azidobutoxy)-2-ethylphenyl]phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CCc1cc(OCCCCN=[N+]=[N-])ccc1-c1ccc(C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC(c2ccccc2)(c2ccc(C)cc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C56H51ClN4O5/c1-3-40-36-44(64-34-14-13-33-59-61-58)31-32-45(40)41-27-25-39(26-28-41)35-53(60-55(63)65-37-50-48-19-9-7-17-46(48)47-18-8-10-20-49(47)50)54(62)66-56(42-15-5-4-6-16-42,43-29-23-38(2)24-30-43)51-21-11-12-22-52(51)57/h4-12,15-32,36,50,53H,3,13-14,33-35,37H2,1-2H3,(H,60,63)/t53-,56?/m0/s1 |
| InChIKey | FSYSUGCKPJUNPR-TVXYMJMNSA-N |
| XLogP | 13.33 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.50 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|