C30H30N4O5 — CID 169300156
(Z,2S)-5-[4-(4-azidobutoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid (PubChem CID 169300156) has the molecular formula C30H30N4O5 and a molecular weight of 526.59 g/mol. Its IUPAC name is (Z,2S)-5-[4-(4-azidobutoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid.
| Compound Name | (Z,2S)-5-[4-(4-azidobutoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
|---|---|
| PubChem CID | 169300156 |
| Molecular Formula | C30H30N4O5 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (Z,2S)-5-[4-(4-azidobutoxy)phenyl]-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-enoic acid |
| SMILES | [N-]=[N+]=NCCCCOc1ccc(/C=C\C[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)cc1 |
| InChI | InChI=1S/C30H30N4O5/c31-34-32-18-5-6-19-38-22-16-14-21(15-17-22)8-7-13-28(29(35)36)33-30(37)39-20-27-25-11-3-1-9-23(25)24-10-2-4-12-26(24)27/h1-4,7-12,14-17,27-28H,5-6,13,18-20H2,(H,33,37)(H,35,36)/b8-7-/t28-/m0/s1 |
| InChIKey | FPKCRODZEMPTGS-LLIWFFSNSA-N |
| XLogP | 6.55 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|