C11H16F3NO3S2 — CID 131846128
4-methylbenzenesulfonic acid;1-(trifluoromethylsulfanyl)propan-2-amine (PubChem CID 131846128) has the molecular formula C11H16F3NO3S2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;1-(trifluoromethylsulfanyl)propan-2-amine.
| Compound Name | 4-methylbenzenesulfonic acid;1-(trifluoromethylsulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 131846128 |
| Molecular Formula | C11H16F3NO3S2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 4-methylbenzenesulfonic acid;1-(trifluoromethylsulfanyl)propan-2-amine |
| SMILES | CC(N)CSC(F)(F)F.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C4H8F3NS/c1-6-2-4-7(5-3-6)11(8,9)10;1-3(8)2-9-4(5,6)7/h2-5H,1H3,(H,8,9,10);3H,2,8H2,1H3 |
| InChIKey | JCJHZYIJCSXYRI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|