C17H17F6NO3S — CID 10137477
(1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;4-methylbenzenesulfonic acid (PubChem CID 10137477) has the molecular formula C17H17F6NO3S and a molecular weight of 429.38 g/mol. Its IUPAC name is (1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;4-methylbenzenesulfonic acid.
| Compound Name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 10137477 |
| Molecular Formula | C17H17F6NO3S |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | (1S)-1-[3,5-bis(trifluoromethyl)phenyl]ethanamine;4-methylbenzenesulfonic acid |
| SMILES | C[C@H](N)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H9F6N.C7H8O3S/c1-5(17)6-2-7(9(11,12)13)4-8(3-6)10(14,15)16;1-6-2-4-7(5-3-6)11(8,9)10/h2-5H,17H2,1H3;2-5H,1H3,(H,8,9,10)/t5-;/m0./s1 |
| InChIKey | GWYPZIQRIIXMOC-JEDNCBNOSA-N |
| XLogP | 4.99 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|