C25H25F6NO3S — CID 171921054
1-[3,5-bis(trifluoromethyl)phenyl]ethyl-(1-phenylethyl)azanium;4-methylbenzenesulfonate (PubChem CID 171921054) has the molecular formula C25H25F6NO3S and a molecular weight of 533.53 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]ethyl-(1-phenylethyl)azanium;4-methylbenzenesulfonate.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethyl-(1-phenylethyl)azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171921054 |
| Molecular Formula | C25H25F6NO3S |
| Molecular Weight | 533.53 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]ethyl-(1-phenylethyl)azanium;4-methylbenzenesulfonate |
| SMILES | CC([NH2+]C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C18H17F6N.C7H8O3S/c1-11(13-6-4-3-5-7-13)25-12(2)14-8-15(17(19,20)21)10-16(9-14)18(22,23)24;1-6-2-4-7(5-3-6)11(8,9)10/h3-12,25H,1-2H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | AUHHDKSBKRTNMT-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.53 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|