C17H28N2O6S — CID 22866696
ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;4-methylbenzenesulfonic acid (PubChem CID 22866696) has the molecular formula C17H28N2O6S and a molecular weight of 388.49 g/mol. Its IUPAC name is ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;4-methylbenzenesulfonic acid.
| Compound Name | ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 22866696 |
| Molecular Formula | C17H28N2O6S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | ethyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;4-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)CNC(=O)[C@@H](N)CC(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C10H20N2O3.C7H8O3S/c1-4-15-9(13)6-12-10(14)8(11)5-7(2)3;1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,4-6,11H2,1-3H3,(H,12,14);2-5H,1H3,(H,8,9,10)/t8-;/m0./s1 |
| InChIKey | OYWHBKWUSRKKLT-QRPNPIFTSA-N |
| XLogP | 1.28 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|