C15H20O4 — CID 150252991
(4,4-dihydroxy-3-methyl-4-phenylbutyl) 2-methylprop-2-enoate (PubChem CID 150252991) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (4,4-dihydroxy-3-methyl-4-phenylbutyl) 2-methylprop-2-enoate.
| Compound Name | (4,4-dihydroxy-3-methyl-4-phenylbutyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150252991 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (4,4-dihydroxy-3-methyl-4-phenylbutyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(C)C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C15H20O4/c1-11(2)14(16)19-10-9-12(3)15(17,18)13-7-5-4-6-8-13/h4-8,12,17-18H,1,9-10H2,2-3H3 |
| InChIKey | FZYMOZPIUCSASE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|