About 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide
3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide (PubChem CID 175823134) has the molecular formula C25H26BrO2P
and a molecular weight of 469.36 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide.
Molecular Properties
| Compound Name | 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide |
| PubChem CID | 175823134 |
| Molecular Formula | C25H26BrO2P |
| Molecular Weight | 469.36 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide |
| SMILES | C=C(C)C(=O)OCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| InChI | InChI=1S/C25H26O2P.BrH/c1-21(2)25(26)27-19-12-20-28(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;/h3-11,13-18H,1,12,19-20H2,2H3;1H/q+1;/p-1 |
| InChIKey | HYWXDPSFPGHRPI-UHFFFAOYSA-M |
| XLogP | 1.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide?
The IUPAC name of 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide (CID 175823134) is 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide.
What is the SMILES notation for 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide?
The canonical SMILES for 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide is C=C(C)C(=O)OCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-].
What is the InChIKey of 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide?
The InChIKey is HYWXDPSFPGHRPI-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H26O2P.BrH/c1-21(2)25(26)27-19-12-20-28(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;/h3-11,13-18H,1,12,19-20H2,2H3;1H/q+1;/p-1.
What are the key properties of 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide?
3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide has a molecular weight of 469.36 g/mol, XLogP of 1.49, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylprop-2-enoyloxy)propyl-triphenylphosphanium bromide is sourced from PubChem (CID 175823134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).