C12H11F3O4 — CID 170414585
[1-(3,4-dihydroxyphenyl)-2,2,2-trifluoroethyl] 2-methylprop-2-enoate (PubChem CID 170414585) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is [1-(3,4-dihydroxyphenyl)-2,2,2-trifluoroethyl] 2-methylprop-2-enoate.
| Compound Name | [1-(3,4-dihydroxyphenyl)-2,2,2-trifluoroethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170414585 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | [1-(3,4-dihydroxyphenyl)-2,2,2-trifluoroethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(c1ccc(O)c(O)c1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O4/c1-6(2)11(18)19-10(12(13,14)15)7-3-4-8(16)9(17)5-7/h3-5,10,16-17H,1H2,2H3 |
| InChIKey | YMXIIFPYVXQFEC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|