C19H23F3O4 — CID 129118522
[2-[1-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)cyclopentyl]phenyl] 2-methylprop-2-enoate (PubChem CID 129118522) has the molecular formula C19H23F3O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is [2-[1-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)cyclopentyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [2-[1-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)cyclopentyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118522 |
| Molecular Formula | C19H23F3O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [2-[1-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)cyclopentyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccccc1C1(OCC(C)(O)C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C19H23F3O4/c1-13(2)16(23)26-15-9-5-4-8-14(15)18(10-6-7-11-18)25-12-17(3,24)19(20,21)22/h4-5,8-9,24H,1,6-7,10-12H2,2-3H3 |
| InChIKey | JTOUVPJYXBWIFL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|