C22H25F3O2 — CID 59330974
(1-naphthalen-1-ylcyclohexyl) 2-methyl-2-(trifluoromethyl)butanoate (PubChem CID 59330974) has the molecular formula C22H25F3O2 and a molecular weight of 378.43 g/mol. Its IUPAC name is (1-naphthalen-1-ylcyclohexyl) 2-methyl-2-(trifluoromethyl)butanoate.
| Compound Name | (1-naphthalen-1-ylcyclohexyl) 2-methyl-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 59330974 |
| Molecular Formula | C22H25F3O2 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (1-naphthalen-1-ylcyclohexyl) 2-methyl-2-(trifluoromethyl)butanoate |
| SMILES | CCC(C)(C(=O)OC1(c2cccc3ccccc23)CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3O2/c1-3-20(2,22(23,24)25)19(26)27-21(14-7-4-8-15-21)18-13-9-11-16-10-5-6-12-17(16)18/h5-6,9-13H,3-4,7-8,14-15H2,1-2H3 |
| InChIKey | YTCCINRPNYMBIQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |