C29H36O10 — CID 159991039
[2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoylperoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] 2-methylprop-2-eneperoxoate (PubChem CID 159991039) has the molecular formula C29H36O10 and a molecular weight of 544.60 g/mol. Its IUPAC name is [2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoylperoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] 2-methylprop-2-eneperoxoate.
| Compound Name | [2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoylperoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] 2-methylprop-2-eneperoxoate |
|---|---|
| PubChem CID | 159991039 |
| Molecular Formula | C29H36O10 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | [2-hydroxy-3-[2-[2-[2-[2-hydroxy-3-(2-methylprop-2-enoylperoxy)propoxy]phenyl]propan-2-yl]phenoxy]propyl] 2-methylprop-2-eneperoxoate |
| SMILES | C=C(C)C(=O)OOCC(O)COc1ccccc1C(C)(C)c1ccccc1OCC(O)COOC(=O)C(=C)C |
| InChI | InChI=1S/C29H36O10/c1-19(2)27(32)38-36-17-21(30)15-34-25-13-9-7-11-23(25)29(5,6)24-12-8-10-14-26(24)35-16-22(31)18-37-39-28(33)20(3)4/h7-14,21-22,30-31H,1,3,15-18H2,2,4-6H3 |
| InChIKey | OGYIAUZZUQVMAF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|