C29H36O8 — CID 57254030
[3-[2-[2-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] but-2-enoate (PubChem CID 57254030) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is [3-[2-[2-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[2-[2-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 57254030 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [3-[2-[2-[2-(3-but-2-enoyloxy-2-hydroxypropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)COc1ccccc1C(C)(C)c1ccccc1OCC(O)COC(=O)C=CC |
| InChI | InChI=1S/C29H36O8/c1-5-11-27(32)36-19-21(30)17-34-25-15-9-7-13-23(25)29(3,4)24-14-8-10-16-26(24)35-18-22(31)20-37-28(33)12-6-2/h5-16,21-22,30-31H,17-20H2,1-4H3 |
| InChIKey | RJGJDYAPBJJGPI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|