C33H25F3O5 — CID 147599534
[4-[4-[[2,3-difluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]methyl]-3-fluorophenyl]phenyl] 2-methylprop-2-enoate (PubChem CID 147599534) has the molecular formula C33H25F3O5 and a molecular weight of 558.55 g/mol. Its IUPAC name is [4-[4-[[2,3-difluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]methyl]-3-fluorophenyl]phenyl] 2-methylprop-2-enoate.
| Compound Name | [4-[4-[[2,3-difluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]methyl]-3-fluorophenyl]phenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 147599534 |
| Molecular Formula | C33H25F3O5 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [4-[4-[[2,3-difluoro-4-[4-(2-methylprop-2-enoyloxy)phenyl]phenoxy]methyl]-3-fluorophenyl]phenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1ccc(-c2ccc(COc3ccc(-c4ccc(OC(=O)C(=C)C)cc4)c(F)c3F)c(F)c2)cc1 |
| InChI | InChI=1S/C33H25F3O5/c1-19(2)32(37)40-25-11-7-21(8-12-25)23-5-6-24(28(34)17-23)18-39-29-16-15-27(30(35)31(29)36)22-9-13-26(14-10-22)41-33(38)20(3)4/h5-17H,1,3,18H2,2,4H3 |
| InChIKey | FZVZPJGFVVGFBD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|