C23H20O3 — CID 134198380
[2-[4-(hydroxymethyl)phenyl]-5-phenylphenyl] 2-methylprop-2-enoate (PubChem CID 134198380) has the molecular formula C23H20O3 and a molecular weight of 344.41 g/mol. Its IUPAC name is [2-[4-(hydroxymethyl)phenyl]-5-phenylphenyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-(hydroxymethyl)phenyl]-5-phenylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 134198380 |
| Molecular Formula | C23H20O3 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [2-[4-(hydroxymethyl)phenyl]-5-phenylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1cc(-c2ccccc2)ccc1-c1ccc(CO)cc1 |
| InChI | InChI=1S/C23H20O3/c1-16(2)23(25)26-22-14-20(18-6-4-3-5-7-18)12-13-21(22)19-10-8-17(15-24)9-11-19/h3-14,24H,1,15H2,2H3 |
| InChIKey | AJXRVGWGZLQBLT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|