[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate

C27H28O2 — CID 118969552

IUPAC[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate
SMILESC=C(CC)C(=O)Oc1cc(-c2ccc(CC)cc2)ccc1-c1ccc(CC)cc1
InChIInChI=1S/C27H28O2/c1-5-19(4)27(28)29-26-18-24(22-12-8-20(6-2)9-13-22)16-17-25(26)23-14-10-21(7-3)11-15-23/h8-18H,4-7H2,1-3H3
InChIKeyRLMRXADSRKMCHQ-UHFFFAOYSA-N
MW384.52 g/mol
LogP7.02
Rot. Bonds7

About [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate

[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate (PubChem CID 118969552) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate.

Molecular Properties

Compound Name[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate
PubChem CID118969552
Molecular FormulaC27H28O2
Molecular Weight384.52 g/mol
Exact Mass384.21
IUPAC Name[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate
SMILESC=C(CC)C(=O)Oc1cc(-c2ccc(CC)cc2)ccc1-c1ccc(CC)cc1
InChIInChI=1S/C27H28O2/c1-5-19(4)27(28)29-26-18-24(22-12-8-20(6-2)9-13-22)16-17-25(26)23-14-10-21(7-3)11-15-23/h8-18H,4-7H2,1-3H3
InChIKeyRLMRXADSRKMCHQ-UHFFFAOYSA-N
XLogP7.02
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500384.52
LogP ≤ 57.02
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate?
The IUPAC name of [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate (CID 118969552) is [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate.
What is the SMILES notation for [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate?
The canonical SMILES for [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate is C=C(CC)C(=O)Oc1cc(-c2ccc(CC)cc2)ccc1-c1ccc(CC)cc1.
What is the InChIKey of [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate?
The InChIKey is RLMRXADSRKMCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H28O2/c1-5-19(4)27(28)29-26-18-24(22-12-8-20(6-2)9-13-22)16-17-25(26)23-14-10-21(7-3)11-15-23/h8-18H,4-7H2,1-3H3.
What are the key properties of [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate?
[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate has a molecular weight of 384.52 g/mol, XLogP of 7.02, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate is sourced from PubChem (CID 118969552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).