C27H28O2 — CID 118969552
[2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate (PubChem CID 118969552) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate.
| Compound Name | [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 118969552 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | [2,5-bis(4-ethylphenyl)phenyl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)Oc1cc(-c2ccc(CC)cc2)ccc1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C27H28O2/c1-5-19(4)27(28)29-26-18-24(22-12-8-20(6-2)9-13-22)16-17-25(26)23-14-10-21(7-3)11-15-23/h8-18H,4-7H2,1-3H3 |
| InChIKey | RLMRXADSRKMCHQ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|