C31H30O7 — CID 147778391
[4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-[(Z)-prop-1-enoxy]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 147778391) has the molecular formula C31H30O7 and a molecular weight of 514.57 g/mol. Its IUPAC name is [4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-[(Z)-prop-1-enoxy]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-[(Z)-prop-1-enoxy]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 147778391 |
| Molecular Formula | C31H30O7 |
| Molecular Weight | 514.57 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [4-[4-[4-[2-(methoxymethyl)prop-2-enoyloxy]phenyl]-3-[(Z)-prop-1-enoxy]phenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)Oc1ccc(-c2ccc(-c3ccc(OC(=O)C(=C)COC)cc3)c(O/C=C\C)c2)cc1 |
| InChI | InChI=1S/C31H30O7/c1-6-17-36-29-18-25(23-7-12-26(13-8-23)37-30(32)21(2)19-34-4)11-16-28(29)24-9-14-27(15-10-24)38-31(33)22(3)20-35-5/h6-18H,2-3,19-20H2,1,4-5H3/b17-6- |
| InChIKey | HHHGUEKJVAHRGO-FMQZQXMHSA-N |
| XLogP | 6.15 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|