C42H42O14 — CID 155139738
[(Z)-2-[4-[2,5-bis[2-(methoxymethyl)prop-2-enoyloxy]-4-[4-[(Z)-2-[2-(methoxymethyl)prop-2-enoyloxy]ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 155139738) has the molecular formula C42H42O14 and a molecular weight of 770.78 g/mol. Its IUPAC name is [(Z)-2-[4-[2,5-bis[2-(methoxymethyl)prop-2-enoyloxy]-4-[4-[(Z)-2-[2-(methoxymethyl)prop-2-enoyloxy]ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [(Z)-2-[4-[2,5-bis[2-(methoxymethyl)prop-2-enoyloxy]-4-[4-[(Z)-2-[2-(methoxymethyl)prop-2-enoyloxy]ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155139738 |
| Molecular Formula | C42H42O14 |
| Molecular Weight | 770.78 g/mol |
| Exact Mass | 770.26 |
| IUPAC Name | [(Z)-2-[4-[2,5-bis[2-(methoxymethyl)prop-2-enoyloxy]-4-[4-[(Z)-2-[2-(methoxymethyl)prop-2-enoyloxy]ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)C(=O)O/C=C\Oc1ccc(-c2cc(OC(=O)C(=C)COC)c(-c3ccc(O/C=C\OC(=O)C(=C)COC)cc3)cc2OC(=O)C(=C)COC)cc1 |
| InChI | InChI=1S/C42H42O14/c1-27(23-47-5)39(43)53-19-17-51-33-13-9-31(10-14-33)35-21-38(56-42(46)30(4)26-50-8)36(22-37(35)55-41(45)29(3)25-49-7)32-11-15-34(16-12-32)52-18-20-54-40(44)28(2)24-48-6/h9-22H,1-4,23-26H2,5-8H3/b19-17-,20-18- |
| InChIKey | KOEHETLHVLCMDZ-CLFAGFIQSA-N |
| XLogP | 6.43 |
| TPSA | 160.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.78 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|