C32H32O7 — CID 155215495
[2-[4-(3-hydroxyprop-1-en-2-yl)phenyl]-5-[2-[4-(3-methoxyprop-1-en-2-ylperoxy)phenyl]ethenyl]phenyl] 2-(methoxymethyl)prop-2-enoate (PubChem CID 155215495) has the molecular formula C32H32O7 and a molecular weight of 528.60 g/mol. Its IUPAC name is [2-[4-(3-hydroxyprop-1-en-2-yl)phenyl]-5-[2-[4-(3-methoxyprop-1-en-2-ylperoxy)phenyl]ethenyl]phenyl] 2-(methoxymethyl)prop-2-enoate.
| Compound Name | [2-[4-(3-hydroxyprop-1-en-2-yl)phenyl]-5-[2-[4-(3-methoxyprop-1-en-2-ylperoxy)phenyl]ethenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
|---|---|
| PubChem CID | 155215495 |
| Molecular Formula | C32H32O7 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [2-[4-(3-hydroxyprop-1-en-2-yl)phenyl]-5-[2-[4-(3-methoxyprop-1-en-2-ylperoxy)phenyl]ethenyl]phenyl] 2-(methoxymethyl)prop-2-enoate |
| SMILES | C=C(COC)OOc1ccc(C=Cc2ccc(-c3ccc(C(=C)CO)cc3)c(OC(=O)C(=C)COC)c2)cc1 |
| InChI | InChI=1S/C32H32O7/c1-22(19-33)27-11-13-28(14-12-27)30-17-10-26(18-31(30)37-32(34)23(2)20-35-4)7-6-25-8-15-29(16-9-25)39-38-24(3)21-36-5/h6-18,33H,1-3,19-21H2,4-5H3 |
| InChIKey | AEPPVMGZKUUCCA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|