C26H28O — CID 118969553
1,4-bis(4-ethylphenyl)-2-(2-methylprop-2-enoxy)benzene (PubChem CID 118969553) has the molecular formula C26H28O and a molecular weight of 356.51 g/mol. Its IUPAC name is 1,4-bis(4-ethylphenyl)-2-(2-methylprop-2-enoxy)benzene.
| Compound Name | 1,4-bis(4-ethylphenyl)-2-(2-methylprop-2-enoxy)benzene |
|---|---|
| PubChem CID | 118969553 |
| Molecular Formula | C26H28O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1,4-bis(4-ethylphenyl)-2-(2-methylprop-2-enoxy)benzene |
| SMILES | C=C(C)COc1cc(-c2ccc(CC)cc2)ccc1-c1ccc(CC)cc1 |
| InChI | InChI=1S/C26H28O/c1-5-20-7-11-22(12-8-20)24-15-16-25(26(17-24)27-18-19(3)4)23-13-9-21(6-2)10-14-23/h7-17H,3,5-6,18H2,1-2,4H3 |
| InChIKey | XDGPRQHWRHJNNH-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|