C10H8F3IO2 — CID 88635335
2-[(2,4,5-trifluoro-6-iodo-3-methylphenoxy)methyl]oxirane (PubChem CID 88635335) has the molecular formula C10H8F3IO2 and a molecular weight of 344.07 g/mol. Its IUPAC name is 2-[(2,4,5-trifluoro-6-iodo-3-methylphenoxy)methyl]oxirane.
| Compound Name | 2-[(2,4,5-trifluoro-6-iodo-3-methylphenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 88635335 |
| Molecular Formula | C10H8F3IO2 |
| Molecular Weight | 344.07 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | 2-[(2,4,5-trifluoro-6-iodo-3-methylphenoxy)methyl]oxirane |
| SMILES | Cc1c(F)c(F)c(I)c(OCC2CO2)c1F |
| InChI | InChI=1S/C10H8F3IO2/c1-4-6(11)8(13)9(14)10(7(4)12)16-3-5-2-15-5/h5H,2-3H2,1H3 |
| InChIKey | OOHPCIDAMCNDOK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.07 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|