C9H5Br5O2 — CID 71364739
2-[(2,3,4,5,6-pentabromophenoxy)methyl]oxirane (PubChem CID 71364739) has the molecular formula C9H5Br5O2 and a molecular weight of 544.66 g/mol. Its IUPAC name is 2-[(2,3,4,5,6-pentabromophenoxy)methyl]oxirane.
| Compound Name | 2-[(2,3,4,5,6-pentabromophenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 71364739 |
| Molecular Formula | C9H5Br5O2 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 539.62 |
| IUPAC Name | 2-[(2,3,4,5,6-pentabromophenoxy)methyl]oxirane |
| SMILES | Brc1c(Br)c(Br)c(OCC2CO2)c(Br)c1Br |
| InChI | InChI=1S/C9H5Br5O2/c10-4-5(11)7(13)9(8(14)6(4)12)16-2-3-1-15-3/h3H,1-2H2 |
| InChIKey | FKDGCMBSOOIJCL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|