C9H5F5O2 — CID 101432995
(2S)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]oxirane (PubChem CID 101432995) has the molecular formula C9H5F5O2 and a molecular weight of 240.13 g/mol. Its IUPAC name is (2S)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]oxirane.
| Compound Name | (2S)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]oxirane |
|---|---|
| PubChem CID | 101432995 |
| Molecular Formula | C9H5F5O2 |
| Molecular Weight | 240.13 g/mol |
| Exact Mass | 240.02 |
| IUPAC Name | (2S)-2-[(2,3,4,5,6-pentafluorophenoxy)methyl]oxirane |
| SMILES | Fc1c(F)c(F)c(OC[C@@H]2CO2)c(F)c1F |
| InChI | InChI=1S/C9H5F5O2/c10-4-5(11)7(13)9(8(14)6(4)12)16-2-3-1-15-3/h3H,1-2H2/t3-/m0/s1 |
| InChIKey | IDVGYFOWVXBGOT-VKHMYHEASA-N |
| XLogP | 2.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.13 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|