C15H17O6Si — CID 23069443
CID 23069443 (PubChem CID 23069443) has the molecular formula C15H17O6Si and a molecular weight of 321.38 g/mol.
| Compound Name | CID 23069443 |
|---|---|
| PubChem CID | 23069443 |
| Molecular Formula | C15H17O6Si |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | — |
| SMILES | [Si]c1ccc(OCC2CO2)c(OCC2CO2)c1OCC1CO1 |
| InChI | InChI=1S/C15H17O6Si/c22-13-2-1-12(19-6-9-3-16-9)14(20-7-10-4-17-10)15(13)21-8-11-5-18-11/h1-2,9-11H,3-8H2 |
| InChIKey | CVQKABQDXXBOCI-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|