C24H26O8 — CID 129094170
2-[[2,4-bis(oxiran-2-ylmethoxy)-3-[2-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane (PubChem CID 129094170) has the molecular formula C24H26O8 and a molecular weight of 442.46 g/mol. Its IUPAC name is 2-[[2,4-bis(oxiran-2-ylmethoxy)-3-[2-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,4-bis(oxiran-2-ylmethoxy)-3-[2-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 129094170 |
| Molecular Formula | C24H26O8 |
| Molecular Weight | 442.46 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-[[2,4-bis(oxiran-2-ylmethoxy)-3-[2-(oxiran-2-ylmethoxy)phenyl]phenoxy]methyl]oxirane |
| SMILES | c1ccc(-c2c(OCC3CO3)ccc(OCC3CO3)c2OCC2CO2)c(OCC2CO2)c1 |
| InChI | InChI=1S/C24H26O8/c1-2-4-20(29-11-15-7-25-15)19(3-1)23-21(30-12-16-8-26-16)5-6-22(31-13-17-9-27-17)24(23)32-14-18-10-28-18/h1-6,15-18H,7-14H2 |
| InChIKey | CFBLZDFTMWHFFN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 87.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|