C55H64O18 — CID 87570449
2-[[3-[3,5-bis[2,3,4-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-2,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (PubChem CID 87570449) has the molecular formula C55H64O18 and a molecular weight of 1013.10 g/mol. Its IUPAC name is 2-[[3-[3,5-bis[2,3,4-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-2,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[3-[3,5-bis[2,3,4-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-2,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87570449 |
| Molecular Formula | C55H64O18 |
| Molecular Weight | 1013.10 g/mol |
| Exact Mass | 1012.41 |
| IUPAC Name | 2-[[3-[3,5-bis[2,3,4-tris(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-2,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| SMILES | c1cc(C23CC4CC(c5ccc(OCC6CO6)c(OCC6CO6)c5OCC5CO5)(C2)CC(c2ccc(OCC5CO5)c(OCC5CO5)c2OCC2CO2)(C4)C3)c(OCC2CO2)c(OCC2CO2)c1OCC1CO1 |
| InChI | InChI=1S/C55H64O18/c1-4-44(65-19-32-10-56-32)50(71-25-38-16-62-38)47(68-22-35-13-59-35)41(1)53-7-31-8-54(28-53,42-2-5-45(66-20-33-11-57-33)51(72-26-39-17-63-39)48(42)69-23-36-14-60-36)30-55(9-31,29-53)43-3-6-46(67-21-34-12-58-34)52(73-27-40-18-64-40)49(43)70-24-37-15-61-37/h1-6,31-40H,7-30H2 |
| InChIKey | FKPHRSAPCHMCLF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 195.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.10 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|