C35H46O6 — CID 87124981
2-[[2,4-bis(1-adamantyl)-3,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane (PubChem CID 87124981) has the molecular formula C35H46O6 and a molecular weight of 562.75 g/mol. Its IUPAC name is 2-[[2,4-bis(1-adamantyl)-3,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[2,4-bis(1-adamantyl)-3,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87124981 |
| Molecular Formula | C35H46O6 |
| Molecular Weight | 562.75 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | 2-[[2,4-bis(1-adamantyl)-3,6-bis(oxiran-2-ylmethoxy)phenoxy]methyl]oxirane |
| SMILES | c1c(OCC2CO2)c(OCC2CO2)c(C23CC4CC(CC(C4)C2)C3)c(OCC2CO2)c1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C35H46O6/c1-20-2-22-3-21(1)9-34(8-20,10-22)29-7-30(39-17-26-14-36-26)33(41-19-28-16-38-28)31(32(29)40-18-27-15-37-27)35-11-23-4-24(12-35)6-25(5-23)13-35/h7,20-28H,1-6,8-19H2 |
| InChIKey | RUDXFSIVWXRUNK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|