C29H38O4 — CID 87124707
2-[[3,5-bis(1-adamantyloxy)phenoxy]methyl]oxirane (PubChem CID 87124707) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-[[3,5-bis(1-adamantyloxy)phenoxy]methyl]oxirane.
| Compound Name | 2-[[3,5-bis(1-adamantyloxy)phenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 87124707 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 2-[[3,5-bis(1-adamantyloxy)phenoxy]methyl]oxirane |
| SMILES | c1c(OCC2CO2)cc(OC23CC4CC(CC(C4)C2)C3)cc1OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H38O4/c1-18-2-20-3-19(1)11-28(10-18,12-20)32-25-7-24(30-16-27-17-31-27)8-26(9-25)33-29-13-21-4-22(14-29)6-23(5-21)15-29/h7-9,18-23,27H,1-6,10-17H2 |
| InChIKey | ZWNDGJICMZXVJN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|