C34H40O8 — CID 163636730
2-[4-[3-[2,4-bis(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-3-(oxiran-2-ylmethoxy)phenoxy]oxetane (PubChem CID 163636730) has the molecular formula C34H40O8 and a molecular weight of 576.69 g/mol. Its IUPAC name is 2-[4-[3-[2,4-bis(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-3-(oxiran-2-ylmethoxy)phenoxy]oxetane.
| Compound Name | 2-[4-[3-[2,4-bis(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-3-(oxiran-2-ylmethoxy)phenoxy]oxetane |
|---|---|
| PubChem CID | 163636730 |
| Molecular Formula | C34H40O8 |
| Molecular Weight | 576.69 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | 2-[4-[3-[2,4-bis(oxiran-2-ylmethoxy)phenyl]-1-adamantyl]-3-(oxiran-2-ylmethoxy)phenoxy]oxetane |
| SMILES | c1cc(C23CC4CC(C2)CC(c2ccc(OC5CCO5)cc2OCC2CO2)(C4)C3)c(OCC2CO2)cc1OCC1CO1 |
| InChI | InChI=1S/C34H40O8/c1-3-28(30(40-18-26-16-38-26)8-23(1)36-14-25-15-37-25)33-10-21-7-22(11-33)13-34(12-21,20-33)29-4-2-24(42-32-5-6-35-32)9-31(29)41-19-27-17-39-27/h1-4,8-9,21-22,25-27,32H,5-7,10-20H2 |
| InChIKey | IATKXSOEKIFQDU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 83.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.69 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|