C22H23NO8 — CID 163682997
[3-(oxiran-2-ylmethoxy)phenyl]methyl N-[[3-(oxetan-2-yloxy)phenyl]methoxycarbonyl]carbamate (PubChem CID 163682997) has the molecular formula C22H23NO8 and a molecular weight of 429.43 g/mol. Its IUPAC name is [3-(oxiran-2-ylmethoxy)phenyl]methyl N-[[3-(oxetan-2-yloxy)phenyl]methoxycarbonyl]carbamate.
| Compound Name | [3-(oxiran-2-ylmethoxy)phenyl]methyl N-[[3-(oxetan-2-yloxy)phenyl]methoxycarbonyl]carbamate |
|---|---|
| PubChem CID | 163682997 |
| Molecular Formula | C22H23NO8 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [3-(oxiran-2-ylmethoxy)phenyl]methyl N-[[3-(oxetan-2-yloxy)phenyl]methoxycarbonyl]carbamate |
| SMILES | O=C(NC(=O)OCc1cccc(OC2CCO2)c1)OCc1cccc(OCC2CO2)c1 |
| InChI | InChI=1S/C22H23NO8/c24-21(29-11-15-3-1-5-17(9-15)27-13-19-14-28-19)23-22(25)30-12-16-4-2-6-18(10-16)31-20-7-8-26-20/h1-6,9-10,19-20H,7-8,11-14H2,(H,23,24,25) |
| InChIKey | JMJUWWCFJTWPAA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 104.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|