C28H6Br18O4 — CID 146497126
2-[bis[2,3,5,6-tetrabromo-4-(2,3,4,5,6-pentabromophenoxy)phenyl]methoxymethyl]oxirane (PubChem CID 146497126) has the molecular formula C28H6Br18O4 and a molecular weight of 1844.62 g/mol. Its IUPAC name is 2-[bis[2,3,5,6-tetrabromo-4-(2,3,4,5,6-pentabromophenoxy)phenyl]methoxymethyl]oxirane.
| Compound Name | 2-[bis[2,3,5,6-tetrabromo-4-(2,3,4,5,6-pentabromophenoxy)phenyl]methoxymethyl]oxirane |
|---|---|
| PubChem CID | 146497126 |
| Molecular Formula | C28H6Br18O4 |
| Molecular Weight | 1844.62 g/mol |
| Exact Mass | 1826.56 |
| IUPAC Name | 2-[bis[2,3,5,6-tetrabromo-4-(2,3,4,5,6-pentabromophenoxy)phenyl]methoxymethyl]oxirane |
| SMILES | Brc1c(Br)c(Br)c(Oc2c(Br)c(Br)c(C(OCC3CO3)c3c(Br)c(Br)c(Oc4c(Br)c(Br)c(Br)c(Br)c4Br)c(Br)c3Br)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C28H6Br18O4/c29-6-4(7(30)17(40)25(16(6)39)49-27-20(43)12(35)10(33)13(36)21(27)44)24(48-2-3-1-47-3)5-8(31)18(41)26(19(42)9(5)32)50-28-22(45)14(37)11(34)15(38)23(28)46/h3,24H,1-2H2 |
| InChIKey | NLQOQDNZYJDHFQ-UHFFFAOYSA-N |
| XLogP | 20.50 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1844.62 |
| LogP ≤ 5 | 20.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|