C29H46NO3P — CID 145362093
2,4-ditert-butyl-6-[1-(3-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1,3,5-trien-5-yl)ethyl]phenol;O-phosphanylhydroxylamine (PubChem CID 145362093) has the molecular formula C29H46NO3P and a molecular weight of 487.67 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[1-(3-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1,3,5-trien-5-yl)ethyl]phenol;O-phosphanylhydroxylamine.
| Compound Name | 2,4-ditert-butyl-6-[1-(3-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1,3,5-trien-5-yl)ethyl]phenol;O-phosphanylhydroxylamine |
|---|---|
| PubChem CID | 145362093 |
| Molecular Formula | C29H46NO3P |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 2,4-ditert-butyl-6-[1-(3-tert-butyl-8,8-dimethyl-7-oxabicyclo[4.2.0]octa-1,3,5-trien-5-yl)ethyl]phenol;O-phosphanylhydroxylamine |
| SMILES | CC(c1cc(C(C)(C)C)cc(C(C)(C)C)c1O)c1cc(C(C)(C)C)cc2c1OC2(C)C.NOP |
| InChI | InChI=1S/C29H42O2.H4NOP/c1-17(20-13-18(26(2,3)4)15-22(24(20)30)28(8,9)10)21-14-19(27(5,6)7)16-23-25(21)31-29(23,11)12;1-2-3/h13-17,30H,1-12H3;1,3H2 |
| InChIKey | NUDYUMYONSKLFB-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|