C39H60O3 — CID 90349212
[2-[1-[2-hydroxy-3-methyl-5-(2-methylheptan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)phenyl] prop-2-enoate (PubChem CID 90349212) has the molecular formula C39H60O3 and a molecular weight of 576.91 g/mol. Its IUPAC name is [2-[1-[2-hydroxy-3-methyl-5-(2-methylheptan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)phenyl] prop-2-enoate.
| Compound Name | [2-[1-[2-hydroxy-3-methyl-5-(2-methylheptan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 90349212 |
| Molecular Formula | C39H60O3 |
| Molecular Weight | 576.91 g/mol |
| Exact Mass | 576.45 |
| IUPAC Name | [2-[1-[2-hydroxy-3-methyl-5-(2-methylheptan-2-yl)phenyl]ethyl]-6-(2-methylbutan-2-yl)-4-(2-methylheptan-2-yl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C(C)c2cc(C(C)(C)CCCCC)cc(C)c2O)cc(C(C)(C)CCCCC)cc1C(C)(C)CC |
| InChI | InChI=1S/C39H60O3/c1-13-17-19-21-38(9,10)29-23-27(5)35(41)31(24-29)28(6)32-25-30(39(11,12)22-20-18-14-2)26-33(37(7,8)16-4)36(32)42-34(40)15-3/h15,23-26,28,41H,3,13-14,16-22H2,1-2,4-12H3 |
| InChIKey | YRKLDGVWMNGGEQ-UHFFFAOYSA-N |
| XLogP | 11.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.91 |
| LogP ≤ 5 | 11.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|